cas: 1026201-95-5 — see every product listed under this CAS number, including other names
3-Bromo-5-(trifluoromethoxy)benzyl alcohol (CAS 1026201-95-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F343034-5G |
| cas | 1026201-95-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1700.46 Pln | |
| Fluorochem | 10g | 2840.68 Pln |
| delivery time | 3-4 weeks |
|---|
[3-bromo-5-(trifluoromethoxy)phenyl]methanol (CAS 1026201-95-5) is a chemical compound with the molecular formula C8H6BrF3O2 and a molecular weight of 271.03 g/mol. IUPAC name: [3-bromo-5-(trifluoromethoxy)phenyl]methanol. InChIKey: CQQFETSXXFSLPO-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O2 |
|---|---|
| Molecular weight | 271.03 g/mol |
| IUPAC name | [3-bromo-5-(trifluoromethoxy)phenyl]methanol |
| InChIKey | CQQFETSXXFSLPO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)Br)CO |
Computed by PubChem (NCBI)