3-Bromo-5-chlorobenzamide, 98%
cas: 933671-77-3 — see every product listed under this CAS number, including other names
3-Bromo-5-chlorobenzamide, 98% (CAS 933671-77-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A287942-1g |
| cas | 933671-77-3 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 25g | 737.50 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 285.20 Pln | |
| Chemat | 25g | 842.00 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 297.70 Pln | |
| BLDpharm | 25g | 786.41 Pln | |
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 508.17 Pln | |
| Fluorochem | 25g | 1559.89 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3-bromo-5-chlorobenzamide (CAS 933671-77-3) is a chemical compound with the molecular formula C7H5BrClNO and a molecular weight of 234.48 g/mol. IUPAC name: 3-bromo-5-chlorobenzamide. InChIKey: IBHVBQAJVLFFCH-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO |
|---|---|
| Molecular weight | 234.48 g/mol |
| IUPAC name | 3-bromo-5-chlorobenzamide |
| InChIKey | IBHVBQAJVLFFCH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Br)C(=O)N |
Computed by PubChem (NCBI)