cas: 855198-27-5 — see every product listed under this CAS number, including other names
3-Bromo-5-ethoxybenzoic acid, ≥95%, ≥95% (CAS 855198-27-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119HKS-1g |
| cas | 855198-27-5 |
| size | 1g |
| availability | 9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 726.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
3-bromo-5-ethoxybenzoic acid (CAS 855198-27-5) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 3-bromo-5-ethoxybenzoic acid. InChIKey: DMIGIIGQWXKUKM-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 3-bromo-5-ethoxybenzoic acid |
| InChIKey | DMIGIIGQWXKUKM-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=CC(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)