cas: 1039364-87-8 — see every product listed under this CAS number, including other names
3-Bromo-6-phenylpyrazolo[1,5-a]pyrimidine 95+% (CAS 1039364-87-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A764316-50mg |
| cas | 1039364-87-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 197.94 Pln | |
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 698.56 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A764316 |
3-bromo-6-phenylpyrazolo[1,5-a]pyrimidine (CAS 1039364-87-8) is a chemical compound with the molecular formula C12H8BrN3 and a molecular weight of 274.12 g/mol. IUPAC name: 3-bromo-6-phenylpyrazolo[1,5-a]pyrimidine. InChIKey: MENYADATKVZLPD-UHFFFAOYSA-N.
| Molecular formula | C12H8BrN3 |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | 3-bromo-6-phenylpyrazolo[1,5-a]pyrimidine |
| InChIKey | MENYADATKVZLPD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN3C(=C(C=N3)Br)N=C2 |
Computed by PubChem (NCBI)