cas: 1190314-17-0 — see every product listed under this CAS number, including other names
3-Bromo-7-azaindole-4-carboxylic acid, 98% (CAS 1190314-17-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A679303-10g |
| cas | 1190314-17-0 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 5505.85 Pln | |
| AmBeed | 25g | 10928.68 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-bromo-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid (CAS 1190314-17-0) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 3-bromo-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid. InChIKey: DLHZKMNKZGVAEW-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 3-bromo-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid |
| InChIKey | DLHZKMNKZGVAEW-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=C1C(=O)O)C(=CN2)Br |
Computed by PubChem (NCBI)