Products 1190314-17-0
CAS 1190314-17-0 appears in our catalog under these names: 3-Bromo-7-azaindole-4-carboxylic acid, 95%, 3-Bromo-7-azaindole-4-carboxylic acid, 98%, 3-Bromo-7-azaindole-4-carboxylic acid, 3-BroMo-7-azaindole-4-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 0,25g, 2g, 100mg, 250mg.
3-bromo-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid (CAS 1190314-17-0) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 3-bromo-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid. InChIKey: DLHZKMNKZGVAEW-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 3-bromo-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid |
| InChIKey | DLHZKMNKZGVAEW-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=C1C(=O)O)C(=CN2)Br |
Computed by PubChem (NCBI)
Synonyms:
1h-pyrrolo[