3-Bromo-7-nitroquinoline, 95%
cas: 1354221-07-0 — see every product listed under this CAS number, including other names
3-Bromo-7-nitroquinoline, 95% (CAS 1354221-07-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg, 10g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A797785-250mg |
| cas | 1354221-07-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 1054.56 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 500mg | 170.00 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 669.20 Pln | |
| Chemat | 10g | 1096.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-bromo-7-nitroquinoline (CAS 1354221-07-0) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 3-bromo-7-nitroquinoline. InChIKey: XIAPLHYFQYRMPL-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 3-bromo-7-nitroquinoline |
| InChIKey | XIAPLHYFQYRMPL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC=C(C=C21)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)