CAS 5341-07-1 appears in our catalog under these names: 3-Bromo-8-nitroquinoline, 95%, 3–Bromo–8–nitroquinoline, 3-bromo-8-nitroquinoline, 97%, 97%, 3-Bromo-8-nitroquinoline, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 25g.
3-bromo-8-nitroquinoline (CAS 5341-07-1) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 3-bromo-8-nitroquinoline. InChIKey: DTXRHWZDVULKEJ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 3-bromo-8-nitroquinoline |
| InChIKey | DTXRHWZDVULKEJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)