CAS 1379345-02-4 appears in our catalog under these names: 4–Bromo–8–nitroquinoline, 4-Bromo-8-nitroquinoline, 95%, 4-Bromo-8-nitroquinoline 95%, 4-Bromo-8-nitroquinoline, 97%, 4-Bromo-8-nitroquinoline, 97%, 97%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-bromo-8-nitroquinoline (CAS 1379345-02-4) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 4-bromo-8-nitroquinoline. InChIKey: PAXJMMPHGVRQJX-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 4-bromo-8-nitroquinoline |
| InChIKey | PAXJMMPHGVRQJX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C(=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)