Products 893723-53-0

CAS 893723-53-0 is the registry number for 3-Bromo-1,8-naphthyridine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-bromo-1,8-naphthyridine-2-carboxylic acid (CAS 893723-53-0) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 3-bromo-1,8-naphthyridine-2-carboxylic acid. InChIKey: FAYPMMVMEAKHFF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5BrN2O2
Molecular weight253.05 g/mol
IUPAC name3-bromo-1,8-naphthyridine-2-carboxylic acid
InChIKeyFAYPMMVMEAKHFF-UHFFFAOYSA-N
SMILESC1=CC2=CC(=C(N=C2N=C1)C(=O)O)Br

Computed by PubChem (NCBI)