CAS 893723-53-0 is the registry number for 3-Bromo-1,8-naphthyridine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
3-bromo-1,8-naphthyridine-2-carboxylic acid (CAS 893723-53-0) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 3-bromo-1,8-naphthyridine-2-carboxylic acid. InChIKey: FAYPMMVMEAKHFF-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 3-bromo-1,8-naphthyridine-2-carboxylic acid |
| InChIKey | FAYPMMVMEAKHFF-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(N=C2N=C1)C(=O)O)Br |
Computed by PubChem (NCBI)