CAS 933486-43-2 is the registry number for 4-Bromo-7-nitroquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
4-bromo-7-nitroquinoline (CAS 933486-43-2) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 4-bromo-7-nitroquinoline. InChIKey: YYOHOYWWIXLLDC-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 4-bromo-7-nitroquinoline |
| InChIKey | YYOHOYWWIXLLDC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)