cas: 143591-61-1 — see every product listed under this CAS number, including other names
3-Bromo-8-chloroimidazo[1,2-a]pyrazine 97% (CAS 143591-61-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A148216-250mg |
| cas | 143591-61-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 303.62 Pln | |
| Ambeed | 25g | 1104.63 Pln | |
| Ambeed | 100g | 3541.00 Pln | |
| Ambeed | 500g | 14315.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A148216 |
3-bromo-8-chloroimidazo[1,2-a]pyrazine (CAS 143591-61-1) is a chemical compound with the molecular formula C6H3BrClN3 and a molecular weight of 232.46 g/mol. IUPAC name: 3-bromo-8-chloroimidazo[1,2-a]pyrazine. InChIKey: MCEGPQSPRNOFMG-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3 |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 3-bromo-8-chloroimidazo[1,2-a]pyrazine |
| InChIKey | MCEGPQSPRNOFMG-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=CN=C2C(=N1)Cl)Br |
Computed by PubChem (NCBI)