cas: 143591-61-1 — see every product listed under this CAS number, including other names
Imidazo[1,2-a]pyrazine, 3-bromo-8-chloro-, 97%, 97% (CAS 143591-61-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118JRM-250mg |
| cas | 143591-61-1 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 198.80 Pln | |
| Chemat | 10g | 318.80 Pln | |
| Chemat | 25g | 664.40 Pln | |
| Chemat | 100g | 2234.00 Pln | |
| Chemat | 50g | 1206.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-bromo-8-chloroimidazo[1,2-a]pyrazine (CAS 143591-61-1) is a chemical compound with the molecular formula C6H3BrClN3 and a molecular weight of 232.46 g/mol. IUPAC name: 3-bromo-8-chloroimidazo[1,2-a]pyrazine. InChIKey: MCEGPQSPRNOFMG-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3 |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 3-bromo-8-chloroimidazo[1,2-a]pyrazine |
| InChIKey | MCEGPQSPRNOFMG-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=CN=C2C(=N1)Cl)Br |
Computed by PubChem (NCBI)