cas: 5341-07-1 — see every product listed under this CAS number, including other names
3-Bromo-8-nitroquinoline, 97% (CAS 5341-07-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F321780-100MG |
| cas | 5341-07-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 299.91 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-8-nitroquinoline (CAS 5341-07-1) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 3-bromo-8-nitroquinoline. InChIKey: DTXRHWZDVULKEJ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 3-bromo-8-nitroquinoline |
| InChIKey | DTXRHWZDVULKEJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)