3-Bromo-8-nitroquinoline, 97%
cas: 5341-07-1 — see every product listed under this CAS number, including other names
3-Bromo-8-nitroquinoline, 97% (CAS 5341-07-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A400095-250mg |
| cas | 5341-07-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 320.31 Pln | |
| Ambeed | 5g | 1126.88 Pln | |
| Ambeed | 10g | 1916.75 Pln | |
| Ambeed | 25g | 3769.06 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 827.60 Pln | |
| Chemat | 25g | 3784.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
3-bromo-8-nitroquinoline (CAS 5341-07-1) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 3-bromo-8-nitroquinoline. InChIKey: DTXRHWZDVULKEJ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 3-bromo-8-nitroquinoline |
| InChIKey | DTXRHWZDVULKEJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)