cas: 78593-33-6 — see every product listed under this CAS number, including other names
3-Bromocinnoline, 95%, 95% (CAS 78593-33-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119MGV-100mg |
| cas | 78593-33-6 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 448.40 Pln | |
| Chemat | 250mg | 842.00 Pln | |
| Chemat | 1g | 2224.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-bromocinnoline (CAS 78593-33-6) is a chemical compound with the molecular formula C8H5BrN2 and a molecular weight of 209.04 g/mol. IUPAC name: 3-bromocinnoline. InChIKey: MEYRUXMLXSGXKP-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2 |
|---|---|
| Molecular weight | 209.04 g/mol |
| IUPAC name | 3-bromocinnoline |
| InChIKey | MEYRUXMLXSGXKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N=N2)Br |
Computed by PubChem (NCBI)