CAS 354574-59-7 appears in our catalog under these names: 4-Bromoquinazoline, 95%, 4-Bromoquinazoline, 97%, 97%, 4-Bromoquinazoline, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg.
4-bromoquinazoline (CAS 354574-59-7) is a chemical compound with the molecular formula C8H5BrN2 and a molecular weight of 209.04 g/mol. IUPAC name: 4-bromoquinazoline. InChIKey: WJYKTNSYMVJDBR-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2 |
|---|---|
| Molecular weight | 209.04 g/mol |
| IUPAC name | 4-bromoquinazoline |
| InChIKey | WJYKTNSYMVJDBR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC=N2)Br |
Computed by PubChem (NCBI)