CAS 61323-17-9 appears in our catalog under these names: 2-Bromo-1,8-naphthyridine, 95%, 2–Bromo–1,8–naphthyridine, 2-Bromo-1,8-naphthyridine, 2-Bromo-1,8-naphthyridine, 97%, 97%, 2-Bromo-1,8-naphthyridine, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 2g, 50mg, 5g, 10g, 500mg.
2-bromo-1,8-naphthyridine (CAS 61323-17-9) is a chemical compound with the molecular formula C8H5BrN2 and a molecular weight of 209.04 g/mol. IUPAC name: 2-bromo-1,8-naphthyridine. InChIKey: BCMGOTDNNMLUBS-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2 |
|---|---|
| Molecular weight | 209.04 g/mol |
| IUPAC name | 2-bromo-1,8-naphthyridine |
| InChIKey | BCMGOTDNNMLUBS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)N=C(C=C2)Br |
Computed by PubChem (NCBI)