Products 63845-72-7
CAS 63845-72-7 appears in our catalog under these names: 8-Bromo-1,7-naphthyridine, 95%, 8–Bromo–1，7–naphthyridine, 8-Bromo-1,7-naphthyridine, 8-Bromo-1,7-naphthyridine 98%, 8-Bromo-1,7-naphthyridine, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg, 0,5g.
8-bromo-1,7-naphthyridine (CAS 63845-72-7) is a chemical compound with the molecular formula C8H5BrN2 and a molecular weight of 209.04 g/mol. IUPAC name: 8-bromo-1,7-naphthyridine. InChIKey: ZMRBFCVWSDKLLT-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2 |
|---|---|
| Molecular weight | 209.04 g/mol |
| IUPAC name | 8-bromo-1,7-naphthyridine |
| InChIKey | ZMRBFCVWSDKLLT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=NC=C2)Br)N=C1 |
Computed by PubChem (NCBI)