CAS 78593-33-6 appears in our catalog under these names: 3-Bromocinnoline, 95%, 3–Bromocinnoline, 3-Bromocinnoline, 3-Bromocinnoline, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 50mg, 0,5g, 5g.
3-bromocinnoline (CAS 78593-33-6) is a chemical compound with the molecular formula C8H5BrN2 and a molecular weight of 209.04 g/mol. IUPAC name: 3-bromocinnoline. InChIKey: MEYRUXMLXSGXKP-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2 |
|---|---|
| Molecular weight | 209.04 g/mol |
| IUPAC name | 3-bromocinnoline |
| InChIKey | MEYRUXMLXSGXKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N=N2)Br |
Computed by PubChem (NCBI)