cas: 1451391-42-6 — see every product listed under this CAS number, including other names
3-CYANO-5-METHYLPHENYLBORONIC ACID, 98% (CAS 1451391-42-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F836396-100MG |
| cas | 1451391-42-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 263.47 Pln | |
| Fluorochem | 250mg | 404.04 Pln | |
| Fluorochem | 1g | 1388.07 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3-cyano-5-methylphenyl)boronic acid (CAS 1451391-42-6) is a chemical compound with the molecular formula C8H8BNO2 and a molecular weight of 160.97 g/mol. IUPAC name: (3-cyano-5-methylphenyl)boronic acid. InChIKey: HOWMWRQDWIZJNA-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO2 |
|---|---|
| Molecular weight | 160.97 g/mol |
| IUPAC name | (3-cyano-5-methylphenyl)boronic acid |
| InChIKey | HOWMWRQDWIZJNA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C#N)C)(O)O |
Computed by PubChem (NCBI)