3-Chloro-1,7-naphthyridin-8(7H)-one, 98%
cas: 1393575-76-2 — see every product listed under this CAS number, including other names
3-Chloro-1,7-naphthyridin-8(7H)-one, 98% (CAS 1393575-76-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A342462-250mg |
| cas | 1393575-76-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1549.62 Pln | |
| Ambeed | 1g | 4075.00 Pln | |
| Ambeed | 5g | 12085.00 Pln | |
| Chemat | 100mg | 664.40 Pln | |
| Chemat | 250mg | 1139.60 Pln | |
| Chemat | 1g | 2973.20 Pln | |
| Chemat | 5g | 12155.60 Pln | |
| BLDpharm | 100mg | 958.58 Pln | |
| BLDpharm | 250mg | 1669.44 Pln | |
| BLDpharm | 1g | 4390.70 Pln | |
| BLDpharm | 5g | 13026.55 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
3-chloro-7H-1,7-naphthyridin-8-one (CAS 1393575-76-2) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 3-chloro-7H-1,7-naphthyridin-8-one. InChIKey: YMLVAQIESQNBHR-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 3-chloro-7H-1,7-naphthyridin-8-one |
| InChIKey | YMLVAQIESQNBHR-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)C2=NC=C(C=C21)Cl |
Computed by PubChem (NCBI)