cas: 157373-00-7 — see every product listed under this CAS number, including other names
3-Chloro-2,4-difluorobenzoyl chloride, 95+% (CAS 157373-00-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A905110-1g |
| cas | 157373-00-7 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 239.26 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-chloro-2,4-difluorobenzoyl chloride (CAS 157373-00-7) is a chemical compound with the molecular formula C7H2Cl2F2O and a molecular weight of 210.99 g/mol. IUPAC name: 3-chloro-2,4-difluorobenzoyl chloride. InChIKey: XGKKQSXUVHMKGM-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F2O |
|---|---|
| Molecular weight | 210.99 g/mol |
| IUPAC name | 3-chloro-2,4-difluorobenzoyl chloride |
| InChIKey | XGKKQSXUVHMKGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)Cl)F)Cl)F |
Computed by PubChem (NCBI)