cas: 157373-00-7 — see every product listed under this CAS number, including other names
3-Chloro-2,4-difluorobenzoyl chloride (CAS 157373-00-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009743-1G |
| cas | 157373-00-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 612.30 Pln | |
| Fluorochem | 10g | 726.85 Pln |
| delivery time | 2-3 weeks |
|---|
3-chloro-2,4-difluorobenzoyl chloride (CAS 157373-00-7) is a chemical compound with the molecular formula C7H2Cl2F2O and a molecular weight of 210.99 g/mol. IUPAC name: 3-chloro-2,4-difluorobenzoyl chloride. InChIKey: XGKKQSXUVHMKGM-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F2O |
|---|---|
| Molecular weight | 210.99 g/mol |
| IUPAC name | 3-chloro-2,4-difluorobenzoyl chloride |
| InChIKey | XGKKQSXUVHMKGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)Cl)F)Cl)F |
Computed by PubChem (NCBI)