cas: 782414-07-7 — see every product listed under this CAS number, including other names
3-Chloro-2-(2,2,2-trifluoroethoxy)aniline 95% (CAS 782414-07-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1160579-250mg |
| cas | 782414-07-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2795.62 Pln | |
| Ambeed | 1g | 5109.62 Pln | |
| Ambeed | 5g | 6122.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1160579 |
3-chloro-2-(2,2,2-trifluoroethoxy)aniline (CAS 782414-07-7) is a chemical compound with the molecular formula C8H7ClF3NO and a molecular weight of 225.59 g/mol. IUPAC name: 3-chloro-2-(2,2,2-trifluoroethoxy)aniline. InChIKey: LLBJPWSONYEMSY-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3NO |
|---|---|
| Molecular weight | 225.59 g/mol |
| IUPAC name | 3-chloro-2-(2,2,2-trifluoroethoxy)aniline |
| InChIKey | LLBJPWSONYEMSY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)OCC(F)(F)F)N |
Computed by PubChem (NCBI)