CAS 186387-90-6 appears in our catalog under these names: 4-Chloro-2-(2,2,2-trifluoroethoxy)aniline, 95%, 4-Chloro-2-(2,2,2-trifluoroethoxy)aniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 100mg.
4-chloro-2-(2,2,2-trifluoroethoxy)aniline (CAS 186387-90-6) is a chemical compound with the molecular formula C8H7ClF3NO and a molecular weight of 225.59 g/mol. IUPAC name: 4-chloro-2-(2,2,2-trifluoroethoxy)aniline. InChIKey: KLRUDTNBNBHCES-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3NO |
|---|---|
| Molecular weight | 225.59 g/mol |
| IUPAC name | 4-chloro-2-(2,2,2-trifluoroethoxy)aniline |
| InChIKey | KLRUDTNBNBHCES-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)OCC(F)(F)F)N |
Computed by PubChem (NCBI)