Products 2288710-41-6
CAS 2288710-41-6 is the registry number for 4-Amino-2-(trifluoromethyl)benzaldehyde hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 100mg, 1g.
4-amino-2-(trifluoromethyl)benzaldehyde;hydrochloride (CAS 2288710-41-6) is a chemical compound with the molecular formula C8H7ClF3NO and a molecular weight of 225.59 g/mol. IUPAC name: 4-amino-2-(trifluoromethyl)benzaldehyde;hydrochloride. InChIKey: WPDLAHRSTQPXIE-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3NO |
|---|---|
| Molecular weight | 225.59 g/mol |
| IUPAC name | 4-amino-2-(trifluoromethyl)benzaldehyde;hydrochloride |
| InChIKey | WPDLAHRSTQPXIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(F)(F)F)C=O.Cl |
Computed by PubChem (NCBI)