Products 1342115-81-4
CAS 1342115-81-4 is the registry number for 4-Chloro-3-(2,2,2-trifluoroethoxy)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-chloro-3-(2,2,2-trifluoroethoxy)aniline (CAS 1342115-81-4) is a chemical compound with the molecular formula C8H7ClF3NO and a molecular weight of 225.59 g/mol. IUPAC name: 4-chloro-3-(2,2,2-trifluoroethoxy)aniline. InChIKey: RFHPBTBJUIEHDI-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3NO |
|---|---|
| Molecular weight | 225.59 g/mol |
| IUPAC name | 4-chloro-3-(2,2,2-trifluoroethoxy)aniline |
| InChIKey | RFHPBTBJUIEHDI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)OCC(F)(F)F)Cl |
Computed by PubChem (NCBI)