Products 1247893-83-9
CAS 1247893-83-9 appears in our catalog under these names: 2-Chloro-4-(2,2,2-trifluoroethoxy)aniline, 95%, 2–Chloro–4–(2，2，2–trifluoroethoxy)aniline. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-chloro-4-(2,2,2-trifluoroethoxy)aniline (CAS 1247893-83-9) is a chemical compound with the molecular formula C8H7ClF3NO and a molecular weight of 225.59 g/mol. IUPAC name: 2-chloro-4-(2,2,2-trifluoroethoxy)aniline. InChIKey: OHLMRTHQMOVZNB-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3NO |
|---|---|
| Molecular weight | 225.59 g/mol |
| IUPAC name | 2-chloro-4-(2,2,2-trifluoroethoxy)aniline |
| InChIKey | OHLMRTHQMOVZNB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCC(F)(F)F)Cl)N |
Computed by PubChem (NCBI)