cas: 1352129-62-4 — see every product listed under this CAS number, including other names
3-Chloro-2-formylphenylboronic acid pinacol ester, ≥95%, ≥95% (CAS 1352129-62-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KXG1-1g |
| cas | 1352129-62-4 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1144.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 1352129-62-4) is a chemical compound with the molecular formula C13H16BClO3 and a molecular weight of 266.53 g/mol. IUPAC name: 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: DVUIUQDBTIPHFS-UHFFFAOYSA-N.
| Molecular formula | C13H16BClO3 |
|---|---|
| Molecular weight | 266.53 g/mol |
| IUPAC name | 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | DVUIUQDBTIPHFS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)Cl)C=O |
Computed by PubChem (NCBI)