Products 1356401-39-2
CAS 1356401-39-2 is the registry number for 2-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde, 98%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 1356401-39-2) is a chemical compound with the molecular formula C13H16BClO3 and a molecular weight of 266.53 g/mol. IUPAC name: 2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: YSSMUYZQTPKESI-UHFFFAOYSA-N.
| Molecular formula | C13H16BClO3 |
|---|---|
| Molecular weight | 266.53 g/mol |
| IUPAC name | 2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | YSSMUYZQTPKESI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)C=O)Cl |
Computed by PubChem (NCBI)