Products 1356642-60-8
CAS 1356642-60-8 appears in our catalog under these names: 2-Chloro-4-formylphenylboronic acid pinacol ester, 98%, 98%, 2-Chloro-4-formylphenylboronic acid pinacol ester, 98%, 3-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g.
3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 1356642-60-8) is a chemical compound with the molecular formula C13H16BClO3 and a molecular weight of 266.53 g/mol. IUPAC name: 3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: UPFNNHCCFWUAEW-UHFFFAOYSA-N.
| Molecular formula | C13H16BClO3 |
|---|---|
| Molecular weight | 266.53 g/mol |
| IUPAC name | 3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | UPFNNHCCFWUAEW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C=O)Cl |
Computed by PubChem (NCBI)