cas: 22233-52-9 — see every product listed under this CAS number, including other names
3-Chloro-2-nitrobenzaldehyde, 97% (CAS 22233-52-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F233906-1G |
| cas | 22233-52-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 596.68 Pln | |
| Fluorochem | 10g | 1132.95 Pln | |
| Fluorochem | 25g | 2262.76 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-chloro-2-nitrobenzaldehyde (CAS 22233-52-9) is a chemical compound with the molecular formula C7H4ClNO3 and a molecular weight of 185.56 g/mol. IUPAC name: 3-chloro-2-nitrobenzaldehyde. InChIKey: WKHILFGJMAXBNZ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3 |
|---|---|
| Molecular weight | 185.56 g/mol |
| IUPAC name | 3-chloro-2-nitrobenzaldehyde |
| InChIKey | WKHILFGJMAXBNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)