CAS 58755-57-0 appears in our catalog under these names: 2-Chloro-3-nitrobenzaldehyde, 95%, 95%, 2-Chloro-3-nitrobenzaldehyde, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
2-chloro-3-nitrobenzaldehyde (CAS 58755-57-0) is a chemical compound with the molecular formula C7H4ClNO3 and a molecular weight of 185.56 g/mol. IUPAC name: 2-chloro-3-nitrobenzaldehyde. InChIKey: WKIVBBWLRIFGHF-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3 |
|---|---|
| Molecular weight | 185.56 g/mol |
| IUPAC name | 2-chloro-3-nitrobenzaldehyde |
| InChIKey | WKIVBBWLRIFGHF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])Cl)C=O |
Computed by PubChem (NCBI)