cas: 23066-21-9 — see every product listed under this CAS number, including other names
3-Chloro-2-nitrophenylacetic acid, >97%, >97% (CAS 23066-21-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113M55-100mg |
| cas | 23066-21-9 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 438.80 Pln | |
| Chemat | 250mg | 597.20 Pln | |
| Chemat | 1g | 1394.00 Pln | |
| Chemat | 5g | 5229.20 Pln | |
| Chemat | 10g | 8334.80 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
2-(3-chloro-2-nitrophenyl)acetic acid (CAS 23066-21-9) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: 2-(3-chloro-2-nitrophenyl)acetic acid. InChIKey: BLJTYQBHLXPJPG-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | 2-(3-chloro-2-nitrophenyl)acetic acid |
| InChIKey | BLJTYQBHLXPJPG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)