3-Chloro-2H-chromen-2-one
cas: 92-45-5 — see every product listed under this CAS number, including other names
3-Chloro-2H-chromen-2-one (CAS 92-45-5) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GT2O-200mg |
| cas | 92-45-5 |
| size | 200mg |
| availability | 10g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 184.40 Pln | |
| Chemat | 1g | 290.00 Pln | |
| Chemat | 5g | 904.40 Pln |
properties
| delivery time | 3 weeks |
|---|
3-chlorochromen-2-one (CAS 92-45-5) is a chemical compound with the molecular formula C9H5ClO2 and a molecular weight of 180.59 g/mol. IUPAC name: 3-chlorochromen-2-one. InChIKey: CKCOPMSBJBNBCQ-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO2 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 3-chlorochromen-2-one |
| InChIKey | CKCOPMSBJBNBCQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=O)O2)Cl |
Computed by PubChem (NCBI)