CAS 207554-23-2 is the registry number for 5-Chloro-1H-indene-1,2(3H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-3H-indene-1,2-dione (CAS 207554-23-2) is a chemical compound with the molecular formula C9H5ClO2 and a molecular weight of 180.59 g/mol. IUPAC name: 5-chloro-3H-indene-1,2-dione. InChIKey: SWHCHEDYHQTQNZ-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO2 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 5-chloro-3H-indene-1,2-dione |
| InChIKey | SWHCHEDYHQTQNZ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)Cl)C(=O)C1=O |
Computed by PubChem (NCBI)