Products 1866562-06-2
CAS 1866562-06-2 appears in our catalog under these names: 3-Chloro-4-ethynylbenzoic acid, 95%, 3–Chloro–4–ethynylbenzoic acid, 3-Chloro-4-ethynylbenzoic acid, 3-Chloro-4-ethynylbenzoic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 10mg.
3-chloro-4-ethynylbenzoic acid (CAS 1866562-06-2) is a chemical compound with the molecular formula C9H5ClO2 and a molecular weight of 180.59 g/mol. IUPAC name: 3-chloro-4-ethynylbenzoic acid. InChIKey: ZQRDNRXPYNBFQB-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO2 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 3-chloro-4-ethynylbenzoic acid |
| InChIKey | ZQRDNRXPYNBFQB-UHFFFAOYSA-N |
| SMILES | C#CC1=C(C=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)