Products 92-45-5
CAS 92-45-5 appears in our catalog under these names: 3-Chlorocoumarin, 98%, 3-Chloro-2H-chromen-2-one, 98%, 3–Chlorocoumarin, 3-Chlorocoumarin, >98.0%(GC), 3-Chlorochromen-2-one. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Biosynth. Available pack sizes: 1g, 25g, 5g, 250mg, 200mg, 2g, 10g.
3-chlorochromen-2-one (CAS 92-45-5) is a chemical compound with the molecular formula C9H5ClO2 and a molecular weight of 180.59 g/mol. IUPAC name: 3-chlorochromen-2-one. InChIKey: CKCOPMSBJBNBCQ-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO2 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 3-chlorochromen-2-one |
| InChIKey | CKCOPMSBJBNBCQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=O)O2)Cl |
Computed by PubChem (NCBI)