cas: 53780-44-2 — see every product listed under this CAS number, including other names
3-Chloro-4,5-difluoronitrobenzene 98% (CAS 53780-44-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A290221-250mg |
| cas | 53780-44-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 476.06 Pln | |
| Ambeed | 25g | 1744.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A290221 |
1-chloro-2,3-difluoro-5-nitrobenzene (CAS 53780-44-2) is a chemical compound with the molecular formula C6H2ClF2NO2 and a molecular weight of 193.53 g/mol. IUPAC name: 1-chloro-2,3-difluoro-5-nitrobenzene. InChIKey: BSKCLLCICPDISV-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO2 |
|---|---|
| Molecular weight | 193.53 g/mol |
| IUPAC name | 1-chloro-2,3-difluoro-5-nitrobenzene |
| InChIKey | BSKCLLCICPDISV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)