CAS 36556-59-9 appears in our catalog under these names: 2-Chloro-3,5-difluoronitrobenzene, 95%, 2-Chloro-3,5-difluoronitrobenzene, 97%, 2-Chloro-3,5-difluoronitrobenzene. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 50mg.
2-chloro-1,5-difluoro-3-nitrobenzene (CAS 36556-59-9) is a chemical compound with the molecular formula C6H2ClF2NO2 and a molecular weight of 193.53 g/mol. IUPAC name: 2-chloro-1,5-difluoro-3-nitrobenzene. InChIKey: RUWWVEDLBSUWIX-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO2 |
|---|---|
| Molecular weight | 193.53 g/mol |
| IUPAC name | 2-chloro-1,5-difluoro-3-nitrobenzene |
| InChIKey | RUWWVEDLBSUWIX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])Cl)F)F |
Computed by PubChem (NCBI)