CAS 53780-44-2 appears in our catalog under these names: 3-Chloro-4,5-difluoronitrobenzene, 96%, 3–Chloro–4,5–Difluoronitrobenzene, 3-Chloro-4,5-difluoronitrobenzene, 98%, 98%, 3-Chloro-4,5-difluoronitrobenzene, 97%, 3-Chloro-4,5-difluoronitrobenzene, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 250mg.
1-chloro-2,3-difluoro-5-nitrobenzene (CAS 53780-44-2) is a chemical compound with the molecular formula C6H2ClF2NO2 and a molecular weight of 193.53 g/mol. IUPAC name: 1-chloro-2,3-difluoro-5-nitrobenzene. InChIKey: BSKCLLCICPDISV-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO2 |
|---|---|
| Molecular weight | 193.53 g/mol |
| IUPAC name | 1-chloro-2,3-difluoro-5-nitrobenzene |
| InChIKey | BSKCLLCICPDISV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)