CAS 3828-41-9 is the registry number for 2-Chloro-1,3-difluoro-5-nitrobenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-chloro-1,3-difluoro-5-nitrobenzene (CAS 3828-41-9) is a chemical compound with the molecular formula C6H2ClF2NO2 and a molecular weight of 193.53 g/mol. IUPAC name: 2-chloro-1,3-difluoro-5-nitrobenzene. InChIKey: QWJLYOSFSRRDLO-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO2 |
|---|---|
| Molecular weight | 193.53 g/mol |
| IUPAC name | 2-chloro-1,3-difluoro-5-nitrobenzene |
| InChIKey | QWJLYOSFSRRDLO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)Cl)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)