cas: 53780-44-2 — see every product listed under this CAS number, including other names
3-Chloro-4,5-difluoronitrobenzene, 98%, 98% (CAS 53780-44-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 25g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DEL8-250mg |
| cas | 53780-44-2 |
| size | 250mg |
| availability | 175g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 25g | 1566.80 Pln | |
| Chemat | 5g | 395.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-chloro-2,3-difluoro-5-nitrobenzene (CAS 53780-44-2) is a chemical compound with the molecular formula C6H2ClF2NO2 and a molecular weight of 193.53 g/mol. IUPAC name: 1-chloro-2,3-difluoro-5-nitrobenzene. InChIKey: BSKCLLCICPDISV-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO2 |
|---|---|
| Molecular weight | 193.53 g/mol |
| IUPAC name | 1-chloro-2,3-difluoro-5-nitrobenzene |
| InChIKey | BSKCLLCICPDISV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)