cas: 849062-39-1 — see every product listed under this CAS number, including other names
3-Chloro-4-(4'-fluorobenzyloxy)phenylboronic acid, 98%, 98% (CAS 849062-39-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114J8P-1g |
| cas | 849062-39-1 |
| size | 1g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 400.40 Pln | |
| Chemat | 5g | 1322.00 Pln | |
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 232.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]boronic acid (CAS 849062-39-1) is a chemical compound with the molecular formula C13H11BClFO3 and a molecular weight of 280.49 g/mol. IUPAC name: [3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]boronic acid. InChIKey: GLLLLVYDIZNTKE-UHFFFAOYSA-N.
| Molecular formula | C13H11BClFO3 |
|---|---|
| Molecular weight | 280.49 g/mol |
| IUPAC name | [3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | GLLLLVYDIZNTKE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCC2=CC=C(C=C2)F)Cl)(O)O |
Computed by PubChem (NCBI)