Products 1256346-27-6

CAS 1256346-27-6 is the registry number for 3-Benzyloxy-4-chloro-2-fluorophenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

(4-chloro-2-fluoro-3-phenylmethoxyphenyl)boronic acid (CAS 1256346-27-6) is a chemical compound with the molecular formula C13H11BClFO3 and a molecular weight of 280.49 g/mol. IUPAC name: (4-chloro-2-fluoro-3-phenylmethoxyphenyl)boronic acid. InChIKey: IPWQADAZCFOAPG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11BClFO3
Molecular weight280.49 g/mol
IUPAC name(4-chloro-2-fluoro-3-phenylmethoxyphenyl)boronic acid
InChIKeyIPWQADAZCFOAPG-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1)Cl)OCC2=CC=CC=C2)F)(O)O

Computed by PubChem (NCBI)