Products 2121512-45-4

CAS 2121512-45-4 is the registry number for 4-Benzyloxy-5-chloro-2-fluorophenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(5-chloro-2-fluoro-4-phenylmethoxyphenyl)boronic acid (CAS 2121512-45-4) is a chemical compound with the molecular formula C13H11BClFO3 and a molecular weight of 280.49 g/mol. IUPAC name: (5-chloro-2-fluoro-4-phenylmethoxyphenyl)boronic acid. InChIKey: OXLOKMDXFGYJIK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11BClFO3
Molecular weight280.49 g/mol
IUPAC name(5-chloro-2-fluoro-4-phenylmethoxyphenyl)boronic acid
InChIKeyOXLOKMDXFGYJIK-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1F)OCC2=CC=CC=C2)Cl)(O)O

Computed by PubChem (NCBI)