Products 1256358-45-8
CAS 1256358-45-8 is the registry number for 3-(2-Chloro-4-fluorophenylmethoxy)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[3-[(2-chloro-4-fluorophenyl)methoxy]phenyl]boronic acid (CAS 1256358-45-8) is a chemical compound with the molecular formula C13H11BClFO3 and a molecular weight of 280.49 g/mol. IUPAC name: [3-[(2-chloro-4-fluorophenyl)methoxy]phenyl]boronic acid. InChIKey: IFDDLUOJDSKVCV-UHFFFAOYSA-N.
| Molecular formula | C13H11BClFO3 |
|---|---|
| Molecular weight | 280.49 g/mol |
| IUPAC name | [3-[(2-chloro-4-fluorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | IFDDLUOJDSKVCV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OCC2=C(C=C(C=C2)F)Cl)(O)O |
Computed by PubChem (NCBI)