CAS 849062-39-1 appears in our catalog under these names: 3-Chloro-4-(4'-fluorobenzyloxy)phenylboronic acid, 98%, 3-Chloro-4-(4'-fluorobenzyloxy)phenylboronic acid, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 25g.
[3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]boronic acid (CAS 849062-39-1) is a chemical compound with the molecular formula C13H11BClFO3 and a molecular weight of 280.49 g/mol. IUPAC name: [3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]boronic acid. InChIKey: GLLLLVYDIZNTKE-UHFFFAOYSA-N.
| Molecular formula | C13H11BClFO3 |
|---|---|
| Molecular weight | 280.49 g/mol |
| IUPAC name | [3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | GLLLLVYDIZNTKE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCC2=CC=C(C=C2)F)Cl)(O)O |
Computed by PubChem (NCBI)