cas: 129604-26-8 — see every product listed under this CAS number, including other names
3-Chloro-4-(trifluoromethoxy)benzonitrile 98% (CAS 129604-26-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A132149-1g |
| cas | 129604-26-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 142.31 Pln | |
| Ambeed | 25g | 431.56 Pln | |
| Ambeed | 100g | 1510.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A132149 |
3-chloro-4-(trifluoromethoxy)benzonitrile (CAS 129604-26-8) is a chemical compound with the molecular formula C8H3ClF3NO and a molecular weight of 221.56 g/mol. IUPAC name: 3-chloro-4-(trifluoromethoxy)benzonitrile. InChIKey: ITKCOGUNHYXLND-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NO |
|---|---|
| Molecular weight | 221.56 g/mol |
| IUPAC name | 3-chloro-4-(trifluoromethoxy)benzonitrile |
| InChIKey | ITKCOGUNHYXLND-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)