CAS 16588-69-5 appears in our catalog under these names: 4-Chloro-2-(trifluoromethyl)phenyl isocyanate, 97%, 4–Chloro–2–(trifluoromethyl)phenyl isocyanate, 4-Chloro-2-(trifluoromethyl)phenyl isocyanate, 97% . Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 5g, 1g, 100g, 25g.
4-chloro-1-isocyanato-2-(trifluoromethyl)benzene (CAS 16588-69-5) is a chemical compound with the molecular formula C8H3ClF3NO and a molecular weight of 221.56 g/mol. IUPAC name: 4-chloro-1-isocyanato-2-(trifluoromethyl)benzene. InChIKey: SBDPJLJFODHSFF-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NO |
|---|---|
| Molecular weight | 221.56 g/mol |
| IUPAC name | 4-chloro-1-isocyanato-2-(trifluoromethyl)benzene |
| InChIKey | SBDPJLJFODHSFF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)N=C=O |
Computed by PubChem (NCBI)